C14H18N4 — CID 107005033
(2,2-dimethylcyclopropyl)-(3-phenyltriazol-4-yl)methanamine (PubChem CID 107005033) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is (2,2-dimethylcyclopropyl)-(3-phenyltriazol-4-yl)methanamine.
| Compound Name | (2,2-dimethylcyclopropyl)-(3-phenyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 107005033 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (2,2-dimethylcyclopropyl)-(3-phenyltriazol-4-yl)methanamine |
| SMILES | CC1(C)CC1C(N)c1cnnn1-c1ccccc1 |
| InChI | InChI=1S/C14H18N4/c1-14(2)8-11(14)13(15)12-9-16-17-18(12)10-6-4-3-5-7-10/h3-7,9,11,13H,8,15H2,1-2H3 |
| InChIKey | IZJAKHCFAPITDV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |