C15H21N5O — CID 114688550
(4-ethylmorpholin-2-yl)-(3-phenyltriazol-4-yl)methanamine (PubChem CID 114688550) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is (4-ethylmorpholin-2-yl)-(3-phenyltriazol-4-yl)methanamine.
| Compound Name | (4-ethylmorpholin-2-yl)-(3-phenyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 114688550 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (4-ethylmorpholin-2-yl)-(3-phenyltriazol-4-yl)methanamine |
| SMILES | CCN1CCOC(C(N)c2cnnn2-c2ccccc2)C1 |
| InChI | InChI=1S/C15H21N5O/c1-2-19-8-9-21-14(11-19)15(16)13-10-17-18-20(13)12-6-4-3-5-7-12/h3-7,10,14-15H,2,8-9,11,16H2,1H3 |
| InChIKey | PTBJPTJVSLKLKS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |