C12H21ClN4O — CID 114657772
(4-chloro-1-ethylpyrazol-5-yl)-(4-ethylmorpholin-2-yl)methanamine (PubChem CID 114657772) has the molecular formula C12H21ClN4O and a molecular weight of 272.78 g/mol. Its IUPAC name is (4-chloro-1-ethylpyrazol-5-yl)-(4-ethylmorpholin-2-yl)methanamine.
| Compound Name | (4-chloro-1-ethylpyrazol-5-yl)-(4-ethylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 114657772 |
| Molecular Formula | C12H21ClN4O |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (4-chloro-1-ethylpyrazol-5-yl)-(4-ethylmorpholin-2-yl)methanamine |
| SMILES | CCN1CCOC(C(N)c2c(Cl)cnn2CC)C1 |
| InChI | InChI=1S/C12H21ClN4O/c1-3-16-5-6-18-10(8-16)11(14)12-9(13)7-15-17(12)4-2/h7,10-11H,3-6,8,14H2,1-2H3 |
| InChIKey | GWFUJLJSWGQQSG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |