C11H15Cl2N3O2 — CID 114386480
4,5-dichloro-2-[(4-ethylmorpholin-2-yl)methyl]pyridazin-3-one (PubChem CID 114386480) has the molecular formula C11H15Cl2N3O2 and a molecular weight of 292.17 g/mol. Its IUPAC name is 4,5-dichloro-2-[(4-ethylmorpholin-2-yl)methyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[(4-ethylmorpholin-2-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114386480 |
| Molecular Formula | C11H15Cl2N3O2 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 4,5-dichloro-2-[(4-ethylmorpholin-2-yl)methyl]pyridazin-3-one |
| SMILES | CCN1CCOC(Cn2ncc(Cl)c(Cl)c2=O)C1 |
| InChI | InChI=1S/C11H15Cl2N3O2/c1-2-15-3-4-18-8(6-15)7-16-11(17)10(13)9(12)5-14-16/h5,8H,2-4,6-7H2,1H3 |
| InChIKey | SVYUHIQNJCHEON-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |