C15H24N2O — CID 79667280
(3,5-dimethylphenyl)-(4-ethylmorpholin-2-yl)methanamine (PubChem CID 79667280) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-(4-ethylmorpholin-2-yl)methanamine.
| Compound Name | (3,5-dimethylphenyl)-(4-ethylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 79667280 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (3,5-dimethylphenyl)-(4-ethylmorpholin-2-yl)methanamine |
| SMILES | CCN1CCOC(C(N)c2cc(C)cc(C)c2)C1 |
| InChI | InChI=1S/C15H24N2O/c1-4-17-5-6-18-14(10-17)15(16)13-8-11(2)7-12(3)9-13/h7-9,14-15H,4-6,10,16H2,1-3H3 |
| InChIKey | KEKMLGNWNVSUHO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |