C15H19ClN2O2 — CID 114729902
(7-chloro-1-benzofuran-2-yl)-(4-ethylmorpholin-2-yl)methanamine (PubChem CID 114729902) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is (7-chloro-1-benzofuran-2-yl)-(4-ethylmorpholin-2-yl)methanamine.
| Compound Name | (7-chloro-1-benzofuran-2-yl)-(4-ethylmorpholin-2-yl)methanamine |
|---|---|
| PubChem CID | 114729902 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (7-chloro-1-benzofuran-2-yl)-(4-ethylmorpholin-2-yl)methanamine |
| SMILES | CCN1CCOC(C(N)c2cc3cccc(Cl)c3o2)C1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-2-18-6-7-19-13(9-18)14(17)12-8-10-4-3-5-11(16)15(10)20-12/h3-5,8,13-14H,2,6-7,9,17H2,1H3 |
| InChIKey | JZXSXUHORIGTBB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |