C13H17F3N2 — CID 107005670
[(2,2-dimethylcyclopropyl)-[2-(trifluoromethyl)phenyl]methyl]hydrazine (PubChem CID 107005670) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is [(2,2-dimethylcyclopropyl)-[2-(trifluoromethyl)phenyl]methyl]hydrazine.
| Compound Name | [(2,2-dimethylcyclopropyl)-[2-(trifluoromethyl)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 107005670 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [(2,2-dimethylcyclopropyl)-[2-(trifluoromethyl)phenyl]methyl]hydrazine |
| SMILES | CC1(C)CC1C(NN)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C13H17F3N2/c1-12(2)7-10(12)11(18-17)8-5-3-4-6-9(8)13(14,15)16/h3-6,10-11,18H,7,17H2,1-2H3 |
| InChIKey | WNXLDBDDNJSGPC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|