C16H23F3N2 — CID 105312456
[(3,4-dimethylcyclohexyl)-[2-(trifluoromethyl)phenyl]methyl]hydrazine (PubChem CID 105312456) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is [(3,4-dimethylcyclohexyl)-[2-(trifluoromethyl)phenyl]methyl]hydrazine.
| Compound Name | [(3,4-dimethylcyclohexyl)-[2-(trifluoromethyl)phenyl]methyl]hydrazine |
|---|---|
| PubChem CID | 105312456 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [(3,4-dimethylcyclohexyl)-[2-(trifluoromethyl)phenyl]methyl]hydrazine |
| SMILES | CC1CCC(C(NN)c2ccccc2C(F)(F)F)CC1C |
| InChI | InChI=1S/C16H23F3N2/c1-10-7-8-12(9-11(10)2)15(21-20)13-5-3-4-6-14(13)16(17,18)19/h3-6,10-12,15,21H,7-9,20H2,1-2H3 |
| InChIKey | OHJZFAXCLJAFPP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|