C17H31NO3 — CID 107010042
tert-butyl 3-hept-6-enyl-4-hydroxypiperidine-1-carboxylate (PubChem CID 107010042) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is tert-butyl 3-hept-6-enyl-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-hept-6-enyl-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 107010042 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | tert-butyl 3-hept-6-enyl-4-hydroxypiperidine-1-carboxylate |
| SMILES | C=CCCCCCC1CN(C(=O)OC(C)(C)C)CCC1O |
| InChI | InChI=1S/C17H31NO3/c1-5-6-7-8-9-10-14-13-18(12-11-15(14)19)16(20)21-17(2,3)4/h5,14-15,19H,1,6-13H2,2-4H3 |
| InChIKey | GUWSXCRMZLCINB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|