C17H30N2O3 — CID 70119511
ethyl 4-[[(1S,2S,5S)-2-hydroxy-5-prop-1-en-2-ylcyclohexyl]methyl]piperazine-1-carboxylate (PubChem CID 70119511) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is ethyl 4-[[(1S,2S,5S)-2-hydroxy-5-prop-1-en-2-ylcyclohexyl]methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[[(1S,2S,5S)-2-hydroxy-5-prop-1-en-2-ylcyclohexyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70119511 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | ethyl 4-[[(1S,2S,5S)-2-hydroxy-5-prop-1-en-2-ylcyclohexyl]methyl]piperazine-1-carboxylate |
| SMILES | C=C(C)[C@H]1CC[C@H](O)[C@H](CN2CCN(C(=O)OCC)CC2)C1 |
| InChI | InChI=1S/C17H30N2O3/c1-4-22-17(21)19-9-7-18(8-10-19)12-15-11-14(13(2)3)5-6-16(15)20/h14-16,20H,2,4-12H2,1,3H3/t14-,15-,16-/m0/s1 |
| InChIKey | UZZSJFNPGOCVNZ-JYJNAYRXSA-N |
| XLogP | 2.11 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|