C17H35N3 — CID 107012550
1-(1-hydrazinyloct-7-enyl)-N,N-dimethylcycloheptan-1-amine (PubChem CID 107012550) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is 1-(1-hydrazinyloct-7-enyl)-N,N-dimethylcycloheptan-1-amine.
| Compound Name | 1-(1-hydrazinyloct-7-enyl)-N,N-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 107012550 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 1-(1-hydrazinyloct-7-enyl)-N,N-dimethylcycloheptan-1-amine |
| SMILES | C=CCCCCCC(NN)C1(N(C)C)CCCCCC1 |
| InChI | InChI=1S/C17H35N3/c1-4-5-6-7-10-13-16(19-18)17(20(2)3)14-11-8-9-12-15-17/h4,16,19H,1,5-15,18H2,2-3H3 |
| InChIKey | SILNFMDWHFMJMA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|