C15H23FN2O — CID 107012577
1-(2-fluoro-6-methoxyphenyl)oct-7-enylhydrazine (PubChem CID 107012577) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 1-(2-fluoro-6-methoxyphenyl)oct-7-enylhydrazine.
| Compound Name | 1-(2-fluoro-6-methoxyphenyl)oct-7-enylhydrazine |
|---|---|
| PubChem CID | 107012577 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-(2-fluoro-6-methoxyphenyl)oct-7-enylhydrazine |
| SMILES | C=CCCCCCC(NN)c1c(F)cccc1OC |
| InChI | InChI=1S/C15H23FN2O/c1-3-4-5-6-7-10-13(18-17)15-12(16)9-8-11-14(15)19-2/h3,8-9,11,13,18H,1,4-7,10,17H2,2H3 |
| InChIKey | PCPDYNQLJXLRLS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|