C13H22N2O3 — CID 105225087
[1-(2,6-dimethoxyphenyl)-4-methoxybutyl]hydrazine (PubChem CID 105225087) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is [1-(2,6-dimethoxyphenyl)-4-methoxybutyl]hydrazine.
| Compound Name | [1-(2,6-dimethoxyphenyl)-4-methoxybutyl]hydrazine |
|---|---|
| PubChem CID | 105225087 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | [1-(2,6-dimethoxyphenyl)-4-methoxybutyl]hydrazine |
| SMILES | COCCCC(NN)c1c(OC)cccc1OC |
| InChI | InChI=1S/C13H22N2O3/c1-16-9-5-6-10(15-14)13-11(17-2)7-4-8-12(13)18-3/h4,7-8,10,15H,5-6,9,14H2,1-3H3 |
| InChIKey | VXIQHYMJVREDKS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|