C14H26F2N2 — CID 107013083
1-(4,4-difluorocyclohexyl)oct-7-enylhydrazine (PubChem CID 107013083) has the molecular formula C14H26F2N2 and a molecular weight of 260.37 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)oct-7-enylhydrazine.
| Compound Name | 1-(4,4-difluorocyclohexyl)oct-7-enylhydrazine |
|---|---|
| PubChem CID | 107013083 |
| Molecular Formula | C14H26F2N2 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)oct-7-enylhydrazine |
| SMILES | C=CCCCCCC(NN)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H26F2N2/c1-2-3-4-5-6-7-13(18-17)12-8-10-14(15,16)11-9-12/h2,12-13,18H,1,3-11,17H2 |
| InChIKey | PVZSZZSKABAHJZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|