C10H16F2N2 — CID 153404812
5-cyclohexyl-2-(difluoromethyl)-1,5-dihydropyrazole (PubChem CID 153404812) has the molecular formula C10H16F2N2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-cyclohexyl-2-(difluoromethyl)-1,5-dihydropyrazole.
| Compound Name | 5-cyclohexyl-2-(difluoromethyl)-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 153404812 |
| Molecular Formula | C10H16F2N2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 5-cyclohexyl-2-(difluoromethyl)-1,5-dihydropyrazole |
| SMILES | FC(F)N1C=CC(C2CCCCC2)N1 |
| InChI | InChI=1S/C10H16F2N2/c11-10(12)14-7-6-9(13-14)8-4-2-1-3-5-8/h6-10,13H,1-5H2 |
| InChIKey | ONNAKNVZHMTGPG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|