C13H26N2 — CID 168921752
2-methyl-5-nonan-4-yl-1,5-dihydropyrazole (PubChem CID 168921752) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 2-methyl-5-nonan-4-yl-1,5-dihydropyrazole.
| Compound Name | 2-methyl-5-nonan-4-yl-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 168921752 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 2-methyl-5-nonan-4-yl-1,5-dihydropyrazole |
| SMILES | CCCCCC(CCC)C1C=CN(C)N1 |
| InChI | InChI=1S/C13H26N2/c1-4-6-7-9-12(8-5-2)13-10-11-15(3)14-13/h10-14H,4-9H2,1-3H3 |
| InChIKey | QZVWSDFRRQESIO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|