C12H23N3 — CID 141003024
2-[2-(aminomethyl)cyclopentyl]-2,3,4,5-tetrahydroazepin-1-amine (PubChem CID 141003024) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 2-[2-(aminomethyl)cyclopentyl]-2,3,4,5-tetrahydroazepin-1-amine.
| Compound Name | 2-[2-(aminomethyl)cyclopentyl]-2,3,4,5-tetrahydroazepin-1-amine |
|---|---|
| PubChem CID | 141003024 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 2-[2-(aminomethyl)cyclopentyl]-2,3,4,5-tetrahydroazepin-1-amine |
| SMILES | NCC1CCCC1C1CCCC=CN1N |
| InChI | InChI=1S/C12H23N3/c13-9-10-5-4-6-11(10)12-7-2-1-3-8-15(12)14/h3,8,10-12H,1-2,4-7,9,13-14H2 |
| InChIKey | GGQBPUUOLUVGMQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|