C12H13FN2O5 — CID 107014145
2-[2-(ethylcarbamoylamino)-2-oxoethoxy]-6-fluorobenzoic acid (PubChem CID 107014145) has the molecular formula C12H13FN2O5 and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-[2-(ethylcarbamoylamino)-2-oxoethoxy]-6-fluorobenzoic acid.
| Compound Name | 2-[2-(ethylcarbamoylamino)-2-oxoethoxy]-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 107014145 |
| Molecular Formula | C12H13FN2O5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[2-(ethylcarbamoylamino)-2-oxoethoxy]-6-fluorobenzoic acid |
| SMILES | CCNC(=O)NC(=O)COc1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C12H13FN2O5/c1-2-14-12(19)15-9(16)6-20-8-5-3-4-7(13)10(8)11(17)18/h3-5H,2,6H2,1H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | MDKOUFAXGZQBGN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |