C16H22FNO3 — CID 107015758
(4-fluoro-2-hydroxyphenyl)-[2-(2-hydroxypropyl)azepan-1-yl]methanone (PubChem CID 107015758) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is (4-fluoro-2-hydroxyphenyl)-[2-(2-hydroxypropyl)azepan-1-yl]methanone.
| Compound Name | (4-fluoro-2-hydroxyphenyl)-[2-(2-hydroxypropyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 107015758 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (4-fluoro-2-hydroxyphenyl)-[2-(2-hydroxypropyl)azepan-1-yl]methanone |
| SMILES | CC(O)CC1CCCCCN1C(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C16H22FNO3/c1-11(19)9-13-5-3-2-4-8-18(13)16(21)14-7-6-12(17)10-15(14)20/h6-7,10-11,13,19-20H,2-5,8-9H2,1H3 |
| InChIKey | KLKMWVVOWIOXJA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |