C17H24FNO2 — CID 79539952
(4-fluoro-3-methylphenyl)-[2-(2-hydroxypropyl)azepan-1-yl]methanone (PubChem CID 79539952) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is (4-fluoro-3-methylphenyl)-[2-(2-hydroxypropyl)azepan-1-yl]methanone.
| Compound Name | (4-fluoro-3-methylphenyl)-[2-(2-hydroxypropyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 79539952 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | (4-fluoro-3-methylphenyl)-[2-(2-hydroxypropyl)azepan-1-yl]methanone |
| SMILES | Cc1cc(C(=O)N2CCCCCC2CC(C)O)ccc1F |
| InChI | InChI=1S/C17H24FNO2/c1-12-10-14(7-8-16(12)18)17(21)19-9-5-3-4-6-15(19)11-13(2)20/h7-8,10,13,15,20H,3-6,9,11H2,1-2H3 |
| InChIKey | ORUFRUPEBOLQIS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |