C12H11FN2O3S — CID 107016499
4-fluoro-2-[(3-propyl-1,2,4-thiadiazol-5-yl)oxy]benzoic acid (PubChem CID 107016499) has the molecular formula C12H11FN2O3S and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-fluoro-2-[(3-propyl-1,2,4-thiadiazol-5-yl)oxy]benzoic acid.
| Compound Name | 4-fluoro-2-[(3-propyl-1,2,4-thiadiazol-5-yl)oxy]benzoic acid |
|---|---|
| PubChem CID | 107016499 |
| Molecular Formula | C12H11FN2O3S |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 4-fluoro-2-[(3-propyl-1,2,4-thiadiazol-5-yl)oxy]benzoic acid |
| SMILES | CCCc1nsc(Oc2cc(F)ccc2C(=O)O)n1 |
| InChI | InChI=1S/C12H11FN2O3S/c1-2-3-10-14-12(19-15-10)18-9-6-7(13)4-5-8(9)11(16)17/h4-6H,2-3H2,1H3,(H,16,17) |
| InChIKey | VXAWPZAFQPDCCK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |