C13H13FN2O3S — CID 107016611
2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-4-fluorobenzoic acid (PubChem CID 107016611) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-4-fluorobenzoic acid.
| Compound Name | 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 107016611 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-4-fluorobenzoic acid |
| SMILES | CC(C)(C)c1nsc(Oc2cc(F)ccc2C(=O)O)n1 |
| InChI | InChI=1S/C13H13FN2O3S/c1-13(2,3)11-15-12(20-16-11)19-9-6-7(14)4-5-8(9)10(17)18/h4-6H,1-3H3,(H,17,18) |
| InChIKey | HHAHYSDLIJMMEX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |