C11H12FN3OS — CID 133494378
3-tert-butyl-5-[(2-fluoro-3-pyridinyl)oxy]-1,2,4-thiadiazole (PubChem CID 133494378) has the molecular formula C11H12FN3OS and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-tert-butyl-5-[(2-fluoro-3-pyridinyl)oxy]-1,2,4-thiadiazole.
| Compound Name | 3-tert-butyl-5-[(2-fluoro-3-pyridinyl)oxy]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133494378 |
| Molecular Formula | C11H12FN3OS |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-tert-butyl-5-[(2-fluoro-3-pyridinyl)oxy]-1,2,4-thiadiazole |
| SMILES | CC(C)(C)c1nsc(Oc2cccnc2F)n1 |
| InChI | InChI=1S/C11H12FN3OS/c1-11(2,3)9-14-10(17-15-9)16-7-5-4-6-13-8(7)12/h4-6H,1-3H3 |
| InChIKey | AMMBHZFPMJSSGA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|