C12H14ClN3OS — CID 65273738
3-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-4-chloroaniline (PubChem CID 65273738) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is 3-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-4-chloroaniline.
| Compound Name | 3-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-4-chloroaniline |
|---|---|
| PubChem CID | 65273738 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 3-[(3-tert-butyl-1,2,4-thiadiazol-5-yl)oxy]-4-chloroaniline |
| SMILES | CC(C)(C)c1nsc(Oc2cc(N)ccc2Cl)n1 |
| InChI | InChI=1S/C12H14ClN3OS/c1-12(2,3)10-15-11(18-16-10)17-9-6-7(14)4-5-8(9)13/h4-6H,14H2,1-3H3 |
| InChIKey | GRVVPBXPOAIIDY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|