C14H10BrCl2NOS — CID 107019931
4-bromo-N-(2,6-dichloro-3-methylphenyl)-2-sulfanylbenzamide (PubChem CID 107019931) has the molecular formula C14H10BrCl2NOS and a molecular weight of 391.12 g/mol. Its IUPAC name is 4-bromo-N-(2,6-dichloro-3-methylphenyl)-2-sulfanylbenzamide.
| Compound Name | 4-bromo-N-(2,6-dichloro-3-methylphenyl)-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 107019931 |
| Molecular Formula | C14H10BrCl2NOS |
| Molecular Weight | 391.12 g/mol |
| Exact Mass | 388.90 |
| IUPAC Name | 4-bromo-N-(2,6-dichloro-3-methylphenyl)-2-sulfanylbenzamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)c2ccc(Br)cc2S)c1Cl |
| InChI | InChI=1S/C14H10BrCl2NOS/c1-7-2-5-10(16)13(12(7)17)18-14(19)9-4-3-8(15)6-11(9)20/h2-6,20H,1H3,(H,18,19) |
| InChIKey | STXAXWLJGQSFLD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.12 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|