C14H9Br2Cl2NO — CID 107979976
3,5-dibromo-N-(2,6-dichloro-3-methylphenyl)benzamide (PubChem CID 107979976) has the molecular formula C14H9Br2Cl2NO and a molecular weight of 437.95 g/mol. Its IUPAC name is 3,5-dibromo-N-(2,6-dichloro-3-methylphenyl)benzamide.
| Compound Name | 3,5-dibromo-N-(2,6-dichloro-3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 107979976 |
| Molecular Formula | C14H9Br2Cl2NO |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 434.84 |
| IUPAC Name | 3,5-dibromo-N-(2,6-dichloro-3-methylphenyl)benzamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)c2cc(Br)cc(Br)c2)c1Cl |
| InChI | InChI=1S/C14H9Br2Cl2NO/c1-7-2-3-11(17)13(12(7)18)19-14(20)8-4-9(15)6-10(16)5-8/h2-6H,1H3,(H,19,20) |
| InChIKey | QRUWTGMBUYJXFK-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |