C15H14Cl2N2O2 — CID 81093926
3-amino-N-(2,6-dichloro-3-methylphenyl)-5-methoxybenzamide (PubChem CID 81093926) has the molecular formula C15H14Cl2N2O2 and a molecular weight of 325.20 g/mol. Its IUPAC name is 3-amino-N-(2,6-dichloro-3-methylphenyl)-5-methoxybenzamide.
| Compound Name | 3-amino-N-(2,6-dichloro-3-methylphenyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 81093926 |
| Molecular Formula | C15H14Cl2N2O2 |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 3-amino-N-(2,6-dichloro-3-methylphenyl)-5-methoxybenzamide |
| SMILES | COc1cc(N)cc(C(=O)Nc2c(Cl)ccc(C)c2Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O2/c1-8-3-4-12(16)14(13(8)17)19-15(20)9-5-10(18)7-11(6-9)21-2/h3-7H,18H2,1-2H3,(H,19,20) |
| InChIKey | XQGQFLOPXADOKN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|