C12H23NOS — CID 107020891
N-cyclohexyl-N,3-dimethyl-2-sulfanylbutanamide (PubChem CID 107020891) has the molecular formula C12H23NOS and a molecular weight of 229.39 g/mol. Its IUPAC name is N-cyclohexyl-N,3-dimethyl-2-sulfanylbutanamide.
| Compound Name | N-cyclohexyl-N,3-dimethyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107020891 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-cyclohexyl-N,3-dimethyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C12H23NOS/c1-9(2)11(15)12(14)13(3)10-7-5-4-6-8-10/h9-11,15H,4-8H2,1-3H3 |
| InChIKey | MJARQKCMSCZSFJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|