C9H17NOS — CID 107022355
N-cyclopropyl-N,3-dimethyl-2-sulfanylbutanamide (PubChem CID 107022355) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is N-cyclopropyl-N,3-dimethyl-2-sulfanylbutanamide.
| Compound Name | N-cyclopropyl-N,3-dimethyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107022355 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | N-cyclopropyl-N,3-dimethyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)N(C)C1CC1 |
| InChI | InChI=1S/C9H17NOS/c1-6(2)8(12)9(11)10(3)7-4-5-7/h6-8,12H,4-5H2,1-3H3 |
| InChIKey | BUODAHYXBKSQRF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|