C8H14ClNO — CID 62729219
3-chloro-N-cyclopropyl-N,2-dimethylpropanamide (PubChem CID 62729219) has the molecular formula C8H14ClNO and a molecular weight of 175.66 g/mol. Its IUPAC name is 3-chloro-N-cyclopropyl-N,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-cyclopropyl-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 62729219 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 3-chloro-N-cyclopropyl-N,2-dimethylpropanamide |
| SMILES | CC(CCl)C(=O)N(C)C1CC1 |
| InChI | InChI=1S/C8H14ClNO/c1-6(5-9)8(11)10(2)7-3-4-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | QMVBBNKJIUCITQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|