C10H20N2OS — CID 107024102
1-[3-(methylaminomethyl)piperidin-1-yl]-3-sulfanylpropan-1-one (PubChem CID 107024102) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 1-[3-(methylaminomethyl)piperidin-1-yl]-3-sulfanylpropan-1-one.
| Compound Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-3-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 107024102 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-[3-(methylaminomethyl)piperidin-1-yl]-3-sulfanylpropan-1-one |
| SMILES | CNCC1CCCN(C(=O)CCS)C1 |
| InChI | InChI=1S/C10H20N2OS/c1-11-7-9-3-2-5-12(8-9)10(13)4-6-14/h9,11,14H,2-8H2,1H3 |
| InChIKey | BYMGXGYLBWXVBW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|