C15H29ClN2O3S — CID 119398208
3-cyclopentylsulfonyl-1-[3-(methylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 119398208) has the molecular formula C15H29ClN2O3S and a molecular weight of 352.93 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-1-[3-(methylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 3-cyclopentylsulfonyl-1-[3-(methylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119398208 |
| Molecular Formula | C15H29ClN2O3S |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 3-cyclopentylsulfonyl-1-[3-(methylaminomethyl)piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | CNCC1CCCN(C(=O)CCS(=O)(=O)C2CCCC2)C1.Cl |
| InChI | InChI=1S/C15H28N2O3S.ClH/c1-16-11-13-5-4-9-17(12-13)15(18)8-10-21(19,20)14-6-2-3-7-14;/h13-14,16H,2-12H2,1H3;1H |
| InChIKey | MORSWAVBBOHNRD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |