C17H18BrNOS — CID 107025803
N-[1-(3-bromophenyl)ethyl]-3-phenyl-2-sulfanylpropanamide (PubChem CID 107025803) has the molecular formula C17H18BrNOS and a molecular weight of 364.31 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethyl]-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-[1-(3-bromophenyl)ethyl]-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107025803 |
| Molecular Formula | C17H18BrNOS |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | N-[1-(3-bromophenyl)ethyl]-3-phenyl-2-sulfanylpropanamide |
| SMILES | CC(NC(=O)C(S)Cc1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H18BrNOS/c1-12(14-8-5-9-15(18)11-14)19-17(20)16(21)10-13-6-3-2-4-7-13/h2-9,11-12,16,21H,10H2,1H3,(H,19,20) |
| InChIKey | UQCJXSUVKDVSIH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|