C12H22N2OS — CID 107025889
N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3-methyl-2-sulfanylbutanamide (PubChem CID 107025889) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3-methyl-2-sulfanylbutanamide.
| Compound Name | N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3-methyl-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107025889 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl)-3-methyl-2-sulfanylbutanamide |
| SMILES | CC(C)C(S)C(=O)NC1CCN2CCCC12 |
| InChI | InChI=1S/C12H22N2OS/c1-8(2)11(16)12(15)13-9-5-7-14-6-3-4-10(9)14/h8-11,16H,3-7H2,1-2H3,(H,13,15) |
| InChIKey | DNKNGDWOJKOAEE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|