C18H31N3O2 — CID 97000583
N-[(2S)-1-[[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]amino]-1-oxopropan-2-yl]cyclohexanecarboxamide (PubChem CID 97000583) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is N-[(2S)-1-[[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]amino]-1-oxopropan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-1-[[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]amino]-1-oxopropan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 97000583 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | N-[(2S)-1-[[(1R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]amino]-1-oxopropan-2-yl]cyclohexanecarboxamide |
| SMILES | C[C@H](NC(=O)C1CCCCC1)C(=O)N[C@@H]1CCN2CCCC[C@H]12 |
| InChI | InChI=1S/C18H31N3O2/c1-13(19-18(23)14-7-3-2-4-8-14)17(22)20-15-10-12-21-11-6-5-9-16(15)21/h13-16H,2-12H2,1H3,(H,19,23)(H,20,22)/t13-,15+,16+/m0/s1 |
| InChIKey | OZUYPZZOSULWFR-NUEKZKHPSA-N |
| XLogP | 1.81 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |