C13H15F2NOS — CID 107025917
N-[(3,4-difluorophenyl)methyl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107025917) has the molecular formula C13H15F2NOS and a molecular weight of 271.33 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 107025917 |
| Molecular Formula | C13H15F2NOS |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | O=C(CC1(CS)CC1)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H15F2NOS/c14-10-2-1-9(5-11(10)15)7-16-12(17)6-13(8-18)3-4-13/h1-2,5,18H,3-4,6-8H2,(H,16,17) |
| InChIKey | RWXOCKRSMYZDPC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|