C16H17NOS2 — CID 107026700
(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(2-methyl-5-sulfanylphenyl)methanone (PubChem CID 107026700) has the molecular formula C16H17NOS2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(2-methyl-5-sulfanylphenyl)methanone.
| Compound Name | (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(2-methyl-5-sulfanylphenyl)methanone |
|---|---|
| PubChem CID | 107026700 |
| Molecular Formula | C16H17NOS2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-(2-methyl-5-sulfanylphenyl)methanone |
| SMILES | Cc1ccc(S)cc1C(=O)N1CCc2sccc2C1C |
| InChI | InChI=1S/C16H17NOS2/c1-10-3-4-12(19)9-14(10)16(18)17-7-5-15-13(11(17)2)6-8-20-15/h3-4,6,8-9,11,19H,5,7H2,1-2H3 |
| InChIKey | KKKXDZPCPPXPLW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|