C15H13BrINOS — CID 103604025
(5-bromo-2-iodophenyl)-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone (PubChem CID 103604025) has the molecular formula C15H13BrINOS and a molecular weight of 462.15 g/mol. Its IUPAC name is (5-bromo-2-iodophenyl)-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone.
| Compound Name | (5-bromo-2-iodophenyl)-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 103604025 |
| Molecular Formula | C15H13BrINOS |
| Molecular Weight | 462.15 g/mol |
| Exact Mass | 460.89 |
| IUPAC Name | (5-bromo-2-iodophenyl)-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)methanone |
| SMILES | CC1c2ccsc2CCN1C(=O)c1cc(Br)ccc1I |
| InChI | InChI=1S/C15H13BrINOS/c1-9-11-5-7-20-14(11)4-6-18(9)15(19)12-8-10(16)2-3-13(12)17/h2-3,5,7-9H,4,6H2,1H3 |
| InChIKey | MBMXLMZTYHJUBZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.15 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|