C16H16BrIN2O — CID 103600033
(5-bromo-2-iodophenyl)-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone (PubChem CID 103600033) has the molecular formula C16H16BrIN2O and a molecular weight of 459.13 g/mol. Its IUPAC name is (5-bromo-2-iodophenyl)-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (5-bromo-2-iodophenyl)-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 103600033 |
| Molecular Formula | C16H16BrIN2O |
| Molecular Weight | 459.13 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | (5-bromo-2-iodophenyl)-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methanone |
| SMILES | Cc1ccc2n1CCN(C(=O)c1cc(Br)ccc1I)C2C |
| InChI | InChI=1S/C16H16BrIN2O/c1-10-3-6-15-11(2)20(8-7-19(10)15)16(21)13-9-12(17)4-5-14(13)18/h3-6,9,11H,7-8H2,1-2H3 |
| InChIKey | ODVHQBCXXFKCPH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|