C11H11FN4OS — CID 107027919
4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylbenzamide (PubChem CID 107027919) has the molecular formula C11H11FN4OS and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylbenzamide.
| Compound Name | 4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107027919 |
| Molecular Formula | C11H11FN4OS |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-sulfanylbenzamide |
| SMILES | Cn1cnnc1CNC(=O)c1ccc(F)c(S)c1 |
| InChI | InChI=1S/C11H11FN4OS/c1-16-6-14-15-10(16)5-13-11(17)7-2-3-8(12)9(18)4-7/h2-4,6,18H,5H2,1H3,(H,13,17) |
| InChIKey | RWIGYRSWNINRDU-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|