C11H10FN5O3 — CID 61052024
4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide (PubChem CID 61052024) has the molecular formula C11H10FN5O3 and a molecular weight of 279.23 g/mol. Its IUPAC name is 4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide.
| Compound Name | 4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 61052024 |
| Molecular Formula | C11H10FN5O3 |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-nitrobenzamide |
| SMILES | Cn1cnnc1CNC(=O)c1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10FN5O3/c1-16-6-14-15-10(16)5-13-11(18)7-2-3-8(12)9(4-7)17(19)20/h2-4,6H,5H2,1H3,(H,13,18) |
| InChIKey | ATUKLONVEKQWCG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|