C16H15F2NOS — CID 107028507
N-[2-(3,5-difluorophenyl)ethyl]-2-methyl-5-sulfanylbenzamide (PubChem CID 107028507) has the molecular formula C16H15F2NOS and a molecular weight of 307.37 g/mol. Its IUPAC name is N-[2-(3,5-difluorophenyl)ethyl]-2-methyl-5-sulfanylbenzamide.
| Compound Name | N-[2-(3,5-difluorophenyl)ethyl]-2-methyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107028507 |
| Molecular Formula | C16H15F2NOS |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[2-(3,5-difluorophenyl)ethyl]-2-methyl-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H15F2NOS/c1-10-2-3-14(21)9-15(10)16(20)19-5-4-11-6-12(17)8-13(18)7-11/h2-3,6-9,21H,4-5H2,1H3,(H,19,20) |
| InChIKey | ZEDMXGLACVBIAU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|