C10H13NO3S — CID 107031183
N-(1,3-dihydroxypropan-2-yl)-3-sulfanylbenzamide (PubChem CID 107031183) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-sulfanylbenzamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107031183 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-sulfanylbenzamide |
| SMILES | O=C(NC(CO)CO)c1cccc(S)c1 |
| InChI | InChI=1S/C10H13NO3S/c12-5-8(6-13)11-10(14)7-2-1-3-9(15)4-7/h1-4,8,12-13,15H,5-6H2,(H,11,14) |
| InChIKey | LLDDALGXAAHZGX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|