C9H15N3O2S — CID 107031951
7-(2-sulfanylpropanoyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 107031951) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 7-(2-sulfanylpropanoyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(2-sulfanylpropanoyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 107031951 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 7-(2-sulfanylpropanoyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | CC(S)C(=O)N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C9H15N3O2S/c1-6(15)8(13)11-2-3-12-7(5-11)4-10-9(12)14/h6-7,15H,2-5H2,1H3,(H,10,14) |
| InChIKey | TVNDERSFKPWUBK-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|