C12H20N4O4 — CID 79094458
2-[methyl-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazine-7-carbonyl)amino]butanoic acid (PubChem CID 79094458) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[methyl-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazine-7-carbonyl)amino]butanoic acid.
| Compound Name | 2-[methyl-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazine-7-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 79094458 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[methyl-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazine-7-carbonyl)amino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)C(=O)N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C12H20N4O4/c1-3-9(10(17)18)14(2)12(20)15-4-5-16-8(7-15)6-13-11(16)19/h8-9H,3-7H2,1-2H3,(H,13,19)(H,17,18) |
| InChIKey | CSAVLHOWYZRFGC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |