C11H20O3 — CID 10703203
[(4R,5S)-5-ethyl-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]methanol (PubChem CID 10703203) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is [(4R,5S)-5-ethyl-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R,5S)-5-ethyl-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 10703203 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | [(4R,5S)-5-ethyl-2,2-dimethyl-5-prop-2-enyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C=CC[C@]1(CC)OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C11H20O3/c1-5-7-11(6-2)9(8-12)13-10(3,4)14-11/h5,9,12H,1,6-8H2,2-4H3/t9-,11+/m1/s1 |
| InChIKey | UOLCEPNJLMIQHO-KOLCDFICSA-N |
| XLogP | 1.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|