About [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol
[(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol (PubChem CID 14190096) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 14190096 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C=CC[C@@]1(CO)COC(C)(C)O1 |
| InChI | InChI=1S/C9H16O3/c1-4-5-9(6-10)7-11-8(2,3)12-9/h4,10H,1,5-7H2,2-3H3/t9-/m1/s1 |
| InChIKey | ZFRRINPIHDJLQV-SECBINFHSA-N |
| XLogP | 1.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol (CID 14190096) is [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol is C=CC[C@@]1(CO)COC(C)(C)O1.
What is the InChIKey of [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol?
The InChIKey is ZFRRINPIHDJLQV-SECBINFHSA-N. The full InChI is InChI=1S/C9H16O3/c1-4-5-9(6-10)7-11-8(2,3)12-9/h4,10H,1,5-7H2,2-3H3/t9-/m1/s1.
What are the key properties of [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol?
[(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol has a molecular weight of 172.22 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 14190096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).