C9H16O3 — CID 14190096
[(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol (PubChem CID 14190096) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 14190096 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(4R)-2,2-dimethyl-4-prop-2-enyl-1,3-dioxolan-4-yl]methanol |
| SMILES | C=CC[C@@]1(CO)COC(C)(C)O1 |
| InChI | InChI=1S/C9H16O3/c1-4-5-9(6-10)7-11-8(2,3)12-9/h4,10H,1,5-7H2,2-3H3/t9-/m1/s1 |
| InChIKey | ZFRRINPIHDJLQV-SECBINFHSA-N |
| XLogP | 1.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|