C14H19NO3S2 — CID 107032922
N-[(1,1-dioxothiolan-2-yl)methyl]-3-phenyl-2-sulfanylpropanamide (PubChem CID 107032922) has the molecular formula C14H19NO3S2 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-2-yl)methyl]-3-phenyl-2-sulfanylpropanamide.
| Compound Name | N-[(1,1-dioxothiolan-2-yl)methyl]-3-phenyl-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107032922 |
| Molecular Formula | C14H19NO3S2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[(1,1-dioxothiolan-2-yl)methyl]-3-phenyl-2-sulfanylpropanamide |
| SMILES | O=C(NCC1CCCS1(=O)=O)C(S)Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO3S2/c16-14(13(19)9-11-5-2-1-3-6-11)15-10-12-7-4-8-20(12,17)18/h1-3,5-6,12-13,19H,4,7-10H2,(H,15,16) |
| InChIKey | NPOOBSYBDYJBGY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|