C12H15NO4S — CID 81046250
phenyl N-[(1,1-dioxothiolan-2-yl)methyl]carbamate (PubChem CID 81046250) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is phenyl N-[(1,1-dioxothiolan-2-yl)methyl]carbamate.
| Compound Name | phenyl N-[(1,1-dioxothiolan-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 81046250 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | phenyl N-[(1,1-dioxothiolan-2-yl)methyl]carbamate |
| SMILES | O=C(NCC1CCCS1(=O)=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H15NO4S/c14-12(17-10-5-2-1-3-6-10)13-9-11-7-4-8-18(11,15)16/h1-3,5-6,11H,4,7-9H2,(H,13,14) |
| InChIKey | UFYWLNQALFEAAN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |