C16H22FNOS — CID 107033555
2-fluoro-N-(2-propan-2-ylcyclohexyl)-5-sulfanylbenzamide (PubChem CID 107033555) has the molecular formula C16H22FNOS and a molecular weight of 295.42 g/mol. Its IUPAC name is 2-fluoro-N-(2-propan-2-ylcyclohexyl)-5-sulfanylbenzamide.
| Compound Name | 2-fluoro-N-(2-propan-2-ylcyclohexyl)-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107033555 |
| Molecular Formula | C16H22FNOS |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-fluoro-N-(2-propan-2-ylcyclohexyl)-5-sulfanylbenzamide |
| SMILES | CC(C)C1CCCCC1NC(=O)c1cc(S)ccc1F |
| InChI | InChI=1S/C16H22FNOS/c1-10(2)12-5-3-4-6-15(12)18-16(19)13-9-11(20)7-8-14(13)17/h7-10,12,15,20H,3-6H2,1-2H3,(H,18,19) |
| InChIKey | SDQLXZYZKRMPEA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|